C15H13F4N3O — CID 46423305
4-fluoro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 46423305) has the molecular formula C15H13F4N3O and a molecular weight of 327.28 g/mol. Its IUPAC name is 4-fluoro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 46423305 |
| Molecular Formula | C15H13F4N3O |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-fluoro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1ccc(C(F)(F)F)cn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13F4N3O/c16-12-4-1-10(2-5-12)14(23)21-8-7-20-13-6-3-11(9-22-13)15(17,18)19/h1-6,9H,7-8H2,(H,20,22)(H,21,23) |
| InChIKey | CQUBSTOSDHMLHG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|