C20H19F3N6O — CID 56919617
N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 56919617) has the molecular formula C20H19F3N6O and a molecular weight of 416.41 g/mol. Its IUPAC name is N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 56919617 |
| Molecular Formula | C20H19F3N6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNC(=O)c3ccc(C(F)(F)F)cc3)nn2)nc1 |
| InChI | InChI=1S/C20H19F3N6O/c1-13-2-7-16(26-12-13)27-18-9-8-17(28-29-18)24-10-11-25-19(30)14-3-5-15(6-4-14)20(21,22)23/h2-9,12H,10-11H2,1H3,(H,24,28)(H,25,30)(H,26,27,29) |
| InChIKey | GCNTUEUAIGGYIA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|