C19H21N7O2 — CID 122326966
2-methoxy-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyridine-4-carboxamide (PubChem CID 122326966) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-methoxy-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-methoxy-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 122326966 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-methoxy-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)NCCNc2ccc(Nc3ccc(C)cn3)nn2)ccn1 |
| InChI | InChI=1S/C19H21N7O2/c1-13-3-4-15(23-12-13)24-17-6-5-16(25-26-17)20-9-10-22-19(27)14-7-8-21-18(11-14)28-2/h3-8,11-12H,9-10H2,1-2H3,(H,20,25)(H,22,27)(H,23,24,26) |
| InChIKey | JMOHRGDTTYILOA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 113.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|