C17H19N7OS — CID 122326956
4-methyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 122326956) has the molecular formula C17H19N7OS and a molecular weight of 369.45 g/mol. Its IUPAC name is 4-methyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122326956 |
| Molecular Formula | C17H19N7OS |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-methyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNC(=O)c3scnc3C)nn2)nc1 |
| InChI | InChI=1S/C17H19N7OS/c1-11-3-4-13(20-9-11)22-15-6-5-14(23-24-15)18-7-8-19-17(25)16-12(2)21-10-26-16/h3-6,9-10H,7-8H2,1-2H3,(H,18,23)(H,19,25)(H,20,22,24) |
| InChIKey | TZWQVHDPLWHOAV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|