C23H23N7O3 — CID 122326923
2-(1,3-dioxoisoindol-2-yl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]propanamide (PubChem CID 122326923) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122326923 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]propanamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNC(=O)C(C)N3C(=O)c4ccccc4C3=O)nn2)nc1 |
| InChI | InChI=1S/C23H23N7O3/c1-14-7-8-18(26-13-14)27-20-10-9-19(28-29-20)24-11-12-25-21(31)15(2)30-22(32)16-5-3-4-6-17(16)23(30)33/h3-10,13,15H,11-12H2,1-2H3,(H,24,28)(H,25,31)(H,26,27,29) |
| InChIKey | FXTUCDNTGRNBFL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|