C18H20N8O — CID 122326959
5-methyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyrazine-2-carboxamide (PubChem CID 122326959) has the molecular formula C18H20N8O and a molecular weight of 364.41 g/mol. Its IUPAC name is 5-methyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 122326959 |
| Molecular Formula | C18H20N8O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 5-methyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyrazine-2-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNC(=O)c3cnc(C)cn3)nn2)nc1 |
| InChI | InChI=1S/C18H20N8O/c1-12-3-4-15(23-9-12)24-17-6-5-16(25-26-17)19-7-8-20-18(27)14-11-21-13(2)10-22-14/h3-6,9-11H,7-8H2,1-2H3,(H,19,25)(H,20,27)(H,23,24,26) |
| InChIKey | OHYWDDMUAGWRHO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|