C19H24N8O — CID 122326916
1,3,5-trimethyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyrazole-4-carboxamide (PubChem CID 122326916) has the molecular formula C19H24N8O and a molecular weight of 380.46 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122326916 |
| Molecular Formula | C19H24N8O |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1,3,5-trimethyl-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNC(=O)c3c(C)nn(C)c3C)nn2)nc1 |
| InChI | InChI=1S/C19H24N8O/c1-12-5-6-15(22-11-12)23-17-8-7-16(24-25-17)20-9-10-21-19(28)18-13(2)26-27(4)14(18)3/h5-8,11H,9-10H2,1-4H3,(H,20,24)(H,21,28)(H,22,23,25) |
| InChIKey | JOTYERVIEFWZNE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|