C19H26N8O — CID 122323865
1,3,5-trimethyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]pyrazole-4-carboxamide (PubChem CID 122323865) has the molecular formula C19H26N8O and a molecular weight of 382.47 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122323865 |
| Molecular Formula | C19H26N8O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1,3,5-trimethyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(NCCNC(=O)c3c(C)nn(C)c3C)nn2)c(C)c1C |
| InChI | InChI=1S/C19H26N8O/c1-11-12(2)25-27(14(11)4)17-8-7-16(22-23-17)20-9-10-21-19(28)18-13(3)24-26(6)15(18)5/h7-8H,9-10H2,1-6H3,(H,20,22)(H,21,28) |
| InChIKey | OBGHYQHYEFQQLN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|