C18H24N8OS — CID 122323766
4-propyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]thiadiazole-5-carboxamide (PubChem CID 122323766) has the molecular formula C18H24N8OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 4-propyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]thiadiazole-5-carboxamide.
| Compound Name | 4-propyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 122323766 |
| Molecular Formula | C18H24N8OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-propyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]thiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NCCNc1ccc(-n2nc(C)c(C)c2C)nn1 |
| InChI | InChI=1S/C18H24N8OS/c1-5-6-14-17(28-25-21-14)18(27)20-10-9-19-15-7-8-16(23-22-15)26-13(4)11(2)12(3)24-26/h7-8H,5-6,9-10H2,1-4H3,(H,19,22)(H,20,27) |
| InChIKey | RZUUYBPAEQOZMP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|