C17H21N7OS — CID 122324002
1-thiophen-2-yl-3-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]urea (PubChem CID 122324002) has the molecular formula C17H21N7OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-thiophen-2-yl-3-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]urea.
| Compound Name | 1-thiophen-2-yl-3-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122324002 |
| Molecular Formula | C17H21N7OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-thiophen-2-yl-3-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]urea |
| SMILES | Cc1nn(-c2ccc(NCCNC(=O)Nc3cccs3)nn2)c(C)c1C |
| InChI | InChI=1S/C17H21N7OS/c1-11-12(2)23-24(13(11)3)15-7-6-14(21-22-15)18-8-9-19-17(25)20-16-5-4-10-26-16/h4-7,10H,8-9H2,1-3H3,(H,18,21)(H2,19,20,25) |
| InChIKey | VJYFTQIRFMPHGB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|