C20H21N7OS — CID 122323775
N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 122323775) has the molecular formula C20H21N7OS and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 122323775 |
| Molecular Formula | C20H21N7OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1nn(-c2ccc(NCCNC(=O)c3ccc4ncsc4c3)nn2)c(C)c1C |
| InChI | InChI=1S/C20H21N7OS/c1-12-13(2)26-27(14(12)3)19-7-6-18(24-25-19)21-8-9-22-20(28)15-4-5-16-17(10-15)29-11-23-16/h4-7,10-11H,8-9H2,1-3H3,(H,21,24)(H,22,28) |
| InChIKey | YPGBEEDLPHJSLY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|