C20H22F2N6OS — CID 122323845
2-(difluoromethylsulfanyl)-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzamide (PubChem CID 122323845) has the molecular formula C20H22F2N6OS and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122323845 |
| Molecular Formula | C20H22F2N6OS |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzamide |
| SMILES | Cc1nn(-c2ccc(NCCNC(=O)c3ccccc3SC(F)F)nn2)c(C)c1C |
| InChI | InChI=1S/C20H22F2N6OS/c1-12-13(2)27-28(14(12)3)18-9-8-17(25-26-18)23-10-11-24-19(29)15-6-4-5-7-16(15)30-20(21)22/h4-9,20H,10-11H2,1-3H3,(H,23,25)(H,24,29) |
| InChIKey | ZSPVCNUPWBFKJR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|