C19H21N7O3 — CID 122324014
2-nitro-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzamide (PubChem CID 122324014) has the molecular formula C19H21N7O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-nitro-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzamide.
| Compound Name | 2-nitro-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122324014 |
| Molecular Formula | C19H21N7O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-nitro-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzamide |
| SMILES | Cc1nn(-c2ccc(NCCNC(=O)c3ccccc3[N+](=O)[O-])nn2)c(C)c1C |
| InChI | InChI=1S/C19H21N7O3/c1-12-13(2)24-25(14(12)3)18-9-8-17(22-23-18)20-10-11-21-19(27)15-6-4-5-7-16(15)26(28)29/h4-9H,10-11H2,1-3H3,(H,20,22)(H,21,27) |
| InChIKey | DRDTUZRRXXCHAH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|