C21H24N6O — CID 122323633
(E)-3-phenyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]prop-2-enamide (PubChem CID 122323633) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is (E)-3-phenyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122323633 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (E)-3-phenyl-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]prop-2-enamide |
| SMILES | Cc1nn(-c2ccc(NCCNC(=O)/C=C/c3ccccc3)nn2)c(C)c1C |
| InChI | InChI=1S/C21H24N6O/c1-15-16(2)26-27(17(15)3)20-11-10-19(24-25-20)22-13-14-23-21(28)12-9-18-7-5-4-6-8-18/h4-12H,13-14H2,1-3H3,(H,22,24)(H,23,28)/b12-9+ |
| InChIKey | HBFWZUGYRFNKCL-FMIVXFBMSA-N |
| XLogP | 2.83 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|