C25H23ClN6O — CID 122292359
(E)-3-(4-chlorophenyl)-N-[4-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]phenyl]prop-2-enamide (PubChem CID 122292359) has the molecular formula C25H23ClN6O and a molecular weight of 458.95 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[4-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[4-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122292359 |
| Molecular Formula | C25H23ClN6O |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[4-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]phenyl]prop-2-enamide |
| SMILES | Cc1nn(-c2ccc(Nc3ccc(NC(=O)/C=C/c4ccc(Cl)cc4)cc3)nn2)c(C)c1C |
| InChI | InChI=1S/C25H23ClN6O/c1-16-17(2)31-32(18(16)3)24-14-13-23(29-30-24)27-21-9-11-22(12-10-21)28-25(33)15-6-19-4-7-20(26)8-5-19/h4-15H,1-3H3,(H,27,29)(H,28,33)/b15-6+ |
| InChIKey | DPYIBNHZOCYVJI-GIDUJCDVSA-N |
| XLogP | 5.64 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|