C18H19FN6O — CID 16654494
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-fluorobenzamide (PubChem CID 16654494) has the molecular formula C18H19FN6O and a molecular weight of 354.39 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 16654494 |
| Molecular Formula | C18H19FN6O |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-fluorobenzamide |
| SMILES | Cc1cc(C)n(-c2ccc(NCCNC(=O)c3ccccc3F)nn2)n1 |
| InChI | InChI=1S/C18H19FN6O/c1-12-11-13(2)25(24-12)17-8-7-16(22-23-17)20-9-10-21-18(26)14-5-3-4-6-15(14)19/h3-8,11H,9-10H2,1-2H3,(H,20,22)(H,21,26) |
| InChIKey | PVXNLRKFPWFERQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|