C17H20N8O2 — CID 122293045
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 122293045) has the molecular formula C17H20N8O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 122293045 |
| Molecular Formula | C17H20N8O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(NCCNC(=O)c3ccc(=O)n(C)n3)nn2)n1 |
| InChI | InChI=1S/C17H20N8O2/c1-11-10-12(2)25(22-11)15-6-5-14(20-21-15)18-8-9-19-17(27)13-4-7-16(26)24(3)23-13/h4-7,10H,8-9H2,1-3H3,(H,18,20)(H,19,27) |
| InChIKey | DFRDGDSZACAMMX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|