C16H17BrN6OS — CID 122293129
4-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 122293129) has the molecular formula C16H17BrN6OS and a molecular weight of 421.32 g/mol. Its IUPAC name is 4-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122293129 |
| Molecular Formula | C16H17BrN6OS |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 4-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(NCCNC(=O)c3cc(Br)cs3)nn2)n1 |
| InChI | InChI=1S/C16H17BrN6OS/c1-10-7-11(2)23(22-10)15-4-3-14(20-21-15)18-5-6-19-16(24)13-8-12(17)9-25-13/h3-4,7-9H,5-6H2,1-2H3,(H,18,20)(H,19,24) |
| InChIKey | KAWYYTIYINRCHV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|