C19H22ClN7O — CID 122293004
1-(2-chloro-4-methylphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]urea (PubChem CID 122293004) has the molecular formula C19H22ClN7O and a molecular weight of 399.89 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]urea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122293004 |
| Molecular Formula | C19H22ClN7O |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCNc2ccc(-n3nc(C)cc3C)nn2)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClN7O/c1-12-4-5-16(15(20)10-12)23-19(28)22-9-8-21-17-6-7-18(25-24-17)27-14(3)11-13(2)26-27/h4-7,10-11H,8-9H2,1-3H3,(H,21,24)(H2,22,23,28) |
| InChIKey | DELBMCGKFRAKFY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|