C23H27ClN6O — CID 122293069
1-(4-chlorophenyl)-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]cyclopentane-1-carboxamide (PubChem CID 122293069) has the molecular formula C23H27ClN6O and a molecular weight of 438.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 122293069 |
| Molecular Formula | C23H27ClN6O |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]cyclopentane-1-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(NCCNC(=O)C3(c4ccc(Cl)cc4)CCCC3)nn2)n1 |
| InChI | InChI=1S/C23H27ClN6O/c1-16-15-17(2)30(29-16)21-10-9-20(27-28-21)25-13-14-26-22(31)23(11-3-4-12-23)18-5-7-19(24)8-6-18/h5-10,15H,3-4,11-14H2,1-2H3,(H,25,27)(H,26,31) |
| InChIKey | JPFCGWNKLQKHOQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|