C20H22N8OS — CID 122293158
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 122293158) has the molecular formula C20H22N8OS and a molecular weight of 422.52 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122293158 |
| Molecular Formula | C20H22N8OS |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(NCCNC(=O)c3cc(-c4cccs4)nn3C)nn2)n1 |
| InChI | InChI=1S/C20H22N8OS/c1-13-11-14(2)28(25-13)19-7-6-18(23-24-19)21-8-9-22-20(29)16-12-15(26-27(16)3)17-5-4-10-30-17/h4-7,10-12H,8-9H2,1-3H3,(H,21,23)(H,22,29) |
| InChIKey | PWFCGCUPDWAKRO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|