C24H23N3OS — CID 4274947
N-(3,3-diphenylpropyl)-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 4274947) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4274947 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-(3,3-diphenylpropyl)-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2cccs2)cc1C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3OS/c1-27-22(17-21(26-27)23-13-8-16-29-23)24(28)25-15-14-20(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-13,16-17,20H,14-15H2,1H3,(H,25,28) |
| InChIKey | BVIKPDYQDBHDKP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |