C20H17N5O2S — CID 71805067
1-methyl-N-[2-(1-methyl-6-oxopyridazin-3-yl)phenyl]-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 71805067) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is 1-methyl-N-[2-(1-methyl-6-oxopyridazin-3-yl)phenyl]-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-(1-methyl-6-oxopyridazin-3-yl)phenyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71805067 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-methyl-N-[2-(1-methyl-6-oxopyridazin-3-yl)phenyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2cccs2)cc1C(=O)Nc1ccccc1-c1ccc(=O)n(C)n1 |
| InChI | InChI=1S/C20H17N5O2S/c1-24-17(12-16(23-24)18-8-5-11-28-18)20(27)21-14-7-4-3-6-13(14)15-9-10-19(26)25(2)22-15/h3-12H,1-2H3,(H,21,27) |
| InChIKey | DAAMWNSAIWSXHD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |