C18H28N4OS — CID 42762160
N-[5-(diethylamino)pentan-2-yl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 42762160) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42762160 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1cc(-c2cccs2)nn1C |
| InChI | InChI=1S/C18H28N4OS/c1-5-22(6-2)11-7-9-14(3)19-18(23)16-13-15(20-21(16)4)17-10-8-12-24-17/h8,10,12-14H,5-7,9,11H2,1-4H3,(H,19,23) |
| InChIKey | ZWBSYMJGYFKRGF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |