C23H28FN3OS — CID 7296623
N-[(2S)-5-(diethylamino)pentan-2-yl]-6-fluoro-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 7296623) has the molecular formula C23H28FN3OS and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[(2S)-5-(diethylamino)pentan-2-yl]-6-fluoro-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[(2S)-5-(diethylamino)pentan-2-yl]-6-fluoro-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 7296623 |
| Molecular Formula | C23H28FN3OS |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[(2S)-5-(diethylamino)pentan-2-yl]-6-fluoro-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | CCN(CC)CCC[C@H](C)NC(=O)c1cc(-c2cccs2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C23H28FN3OS/c1-4-27(5-2)12-6-8-16(3)25-23(28)19-15-21(22-9-7-13-29-22)26-20-11-10-17(24)14-18(19)20/h7,9-11,13-16H,4-6,8,12H2,1-3H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | CDLCXDAHPIFRPX-INIZCTEOSA-N |
| XLogP | 5.34 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |