C28H21FN2OS — CID 93097670
N-[(1S)-1,2-diphenylethyl]-6-fluoro-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 93097670) has the molecular formula C28H21FN2OS and a molecular weight of 452.55 g/mol. Its IUPAC name is N-[(1S)-1,2-diphenylethyl]-6-fluoro-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[(1S)-1,2-diphenylethyl]-6-fluoro-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 93097670 |
| Molecular Formula | C28H21FN2OS |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[(1S)-1,2-diphenylethyl]-6-fluoro-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)c1ccccc1)c1cc(-c2cccs2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C28H21FN2OS/c29-21-13-14-24-22(17-21)23(18-26(30-24)27-12-7-15-33-27)28(32)31-25(20-10-5-2-6-11-20)16-19-8-3-1-4-9-19/h1-15,17-18,25H,16H2,(H,31,32)/t25-/m0/s1 |
| InChIKey | XMJOGKMJRNJQPE-VWLOTQADSA-N |
| XLogP | 6.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |