C26H23FN2OS — CID 42750188
(4-benzylpiperidin-1-yl)-(6-fluoro-2-thiophen-2-ylquinolin-4-yl)methanone (PubChem CID 42750188) has the molecular formula C26H23FN2OS and a molecular weight of 430.55 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-(6-fluoro-2-thiophen-2-ylquinolin-4-yl)methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-(6-fluoro-2-thiophen-2-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 42750188 |
| Molecular Formula | C26H23FN2OS |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-(6-fluoro-2-thiophen-2-ylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2cccs2)nc2ccc(F)cc12)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H23FN2OS/c27-20-8-9-23-21(16-20)22(17-24(28-23)25-7-4-14-31-25)26(30)29-12-10-19(11-13-29)15-18-5-2-1-3-6-18/h1-9,14,16-17,19H,10-13,15H2 |
| InChIKey | VXIFBYBZCNSAQP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |