C24H20FN3OS — CID 4584269
[4-(2-fluorophenyl)piperazin-1-yl]-(2-thiophen-2-ylquinolin-4-yl)methanone (PubChem CID 4584269) has the molecular formula C24H20FN3OS and a molecular weight of 417.51 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-(2-thiophen-2-ylquinolin-4-yl)methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-(2-thiophen-2-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 4584269 |
| Molecular Formula | C24H20FN3OS |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-(2-thiophen-2-ylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2cccs2)nc2ccccc12)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H20FN3OS/c25-19-7-2-4-9-22(19)27-11-13-28(14-12-27)24(29)18-16-21(23-10-5-15-30-23)26-20-8-3-1-6-17(18)20/h1-10,15-16H,11-14H2 |
| InChIKey | AGVWENKFSHEFSX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |