C20H23Cl2N3OS — CID 119559766
[4-(methylamino)piperidin-1-yl]-(2-thiophen-2-ylquinolin-4-yl)methanone;dihydrochloride (PubChem CID 119559766) has the molecular formula C20H23Cl2N3OS and a molecular weight of 424.40 g/mol. Its IUPAC name is [4-(methylamino)piperidin-1-yl]-(2-thiophen-2-ylquinolin-4-yl)methanone;dihydrochloride.
| Compound Name | [4-(methylamino)piperidin-1-yl]-(2-thiophen-2-ylquinolin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119559766 |
| Molecular Formula | C20H23Cl2N3OS |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [4-(methylamino)piperidin-1-yl]-(2-thiophen-2-ylquinolin-4-yl)methanone;dihydrochloride |
| SMILES | CNC1CCN(C(=O)c2cc(-c3cccs3)nc3ccccc23)CC1.Cl.Cl |
| InChI | InChI=1S/C20H21N3OS.2ClH/c1-21-14-8-10-23(11-9-14)20(24)16-13-18(19-7-4-12-25-19)22-17-6-3-2-5-15(16)17;;/h2-7,12-14,21H,8-11H2,1H3;2*1H |
| InChIKey | ABIMRBLTVFWEIM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |