C26H24N4O2S — CID 55501818
N-[1-(phenylcarbamoyl)piperidin-4-yl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 55501818) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[1-(phenylcarbamoyl)piperidin-4-yl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[1-(phenylcarbamoyl)piperidin-4-yl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55501818 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | N-[1-(phenylcarbamoyl)piperidin-4-yl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)Nc2ccccc2)CC1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C26H24N4O2S/c31-25(21-17-23(24-11-6-16-33-24)29-22-10-5-4-9-20(21)22)27-19-12-14-30(15-13-19)26(32)28-18-7-2-1-3-8-18/h1-11,16-17,19H,12-15H2,(H,27,31)(H,28,32) |
| InChIKey | ONCKRLOIQKJSLI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |