C27H26N4O2S — CID 25397691
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 25397691) has the molecular formula C27H26N4O2S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 25397691 |
| Molecular Formula | C27H26N4O2S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(CN1CCC(NC(=O)c2cc(-c3cccs3)nc3ccccc23)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C27H26N4O2S/c32-26(28-19-7-2-1-3-8-19)18-31-14-12-20(13-15-31)29-27(33)22-17-24(25-11-6-16-34-25)30-23-10-5-4-9-21(22)23/h1-11,16-17,20H,12-15,18H2,(H,28,32)(H,29,33) |
| InChIKey | AWFKGPGPKOJUMW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |