C24H21N3O3S2 — CID 2444020
N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 2444020) has the molecular formula C24H21N3O3S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 2444020 |
| Molecular Formula | C24H21N3O3S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C24H21N3O3S2/c28-24(25-17-9-11-18(12-10-17)32(29,30)27-13-3-4-14-27)20-16-22(23-8-5-15-31-23)26-21-7-2-1-6-19(20)21/h1-2,5-12,15-16H,3-4,13-14H2,(H,25,28) |
| InChIKey | OCPVARSQQPZVKB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |