C34H21N5O4S2 — CID 3584085
N-[4-nitro-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]phenyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 3584085) has the molecular formula C34H21N5O4S2 and a molecular weight of 627.71 g/mol. Its IUPAC name is N-[4-nitro-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]phenyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[4-nitro-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]phenyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3584085 |
| Molecular Formula | C34H21N5O4S2 |
| Molecular Weight | 627.71 g/mol |
| Exact Mass | 627.10 |
| IUPAC Name | N-[4-nitro-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]phenyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(NC(=O)c2cc(-c3cccs3)nc3ccccc23)c1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C34H21N5O4S2/c40-33(23-18-28(31-11-5-15-44-31)36-25-9-3-1-7-21(23)25)35-20-13-14-30(39(42)43)27(17-20)38-34(41)24-19-29(32-12-6-16-45-32)37-26-10-4-2-8-22(24)26/h1-19H,(H,35,40)(H,38,41) |
| InChIKey | SUVQISKRZQYQLV-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.71 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|