C22H18ClN3O3S2 — CID 4989292
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 4989292) has the molecular formula C22H18ClN3O3S2 and a molecular weight of 471.99 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4989292 |
| Molecular Formula | C22H18ClN3O3S2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)c2cc(-c3cccs3)nc3ccccc23)ccc1Cl |
| InChI | InChI=1S/C22H18ClN3O3S2/c1-26(2)31(28,29)21-12-14(9-10-17(21)23)24-22(27)16-13-19(20-8-5-11-30-20)25-18-7-4-3-6-15(16)18/h3-13H,1-2H3,(H,24,27) |
| InChIKey | RGAQQFSOQVRNOL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |