C27H21N3O3S2 — CID 2965579
N-[4-(benzylsulfamoyl)phenyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 2965579) has the molecular formula C27H21N3O3S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[4-(benzylsulfamoyl)phenyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[4-(benzylsulfamoyl)phenyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 2965579 |
| Molecular Formula | C27H21N3O3S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-[4-(benzylsulfamoyl)phenyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C27H21N3O3S2/c31-27(23-17-25(26-11-6-16-34-26)30-24-10-5-4-9-22(23)24)29-20-12-14-21(15-13-20)35(32,33)28-18-19-7-2-1-3-8-19/h1-17,28H,18H2,(H,29,31) |
| InChIKey | FTJNJAUONXODTR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |