C24H22N4O3S — CID 21227643
N-[4-(propylsulfamoyl)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 21227643) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[4-(propylsulfamoyl)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[4-(propylsulfamoyl)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 21227643 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[4-(propylsulfamoyl)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)c2cc(-c3ccncc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-2-13-26-32(30,31)19-9-7-18(8-10-19)27-24(29)21-16-23(17-11-14-25-15-12-17)28-22-6-4-3-5-20(21)22/h3-12,14-16,26H,2,13H2,1H3,(H,27,29) |
| InChIKey | GSRFYJRSOVHTBV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |