C29H22FN3O3S — CID 2439803
2-(4-fluorophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]quinoline-4-carboxamide (PubChem CID 2439803) has the molecular formula C29H22FN3O3S and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2439803 |
| Molecular Formula | C29H22FN3O3S |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]quinoline-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NC(=O)c3cc(-c4ccc(F)cc4)nc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C29H22FN3O3S/c1-19-6-16-24(17-7-19)37(35,36)33-23-14-12-22(13-15-23)31-29(34)26-18-28(20-8-10-21(30)11-9-20)32-27-5-3-2-4-25(26)27/h2-18,33H,1H3,(H,31,34) |
| InChIKey | CPZXQWKUZXNFRM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |