C30H25N3O4S — CID 3672707
2-(4-methoxyphenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]quinoline-4-carboxamide (PubChem CID 3672707) has the molecular formula C30H25N3O4S and a molecular weight of 523.61 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3672707 |
| Molecular Formula | C30H25N3O4S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccc(NS(=O)(=O)c4ccc(C)cc4)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C30H25N3O4S/c1-20-7-17-25(18-8-20)38(35,36)33-23-13-11-22(12-14-23)31-30(34)27-19-29(21-9-15-24(37-2)16-10-21)32-28-6-4-3-5-26(27)28/h3-19,33H,1-2H3,(H,31,34) |
| InChIKey | IDVXTZSROCHEJX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |