C24H20N2O2 — CID 164616063
7-methoxy-N-(4-methylphenyl)-2-phenylquinoline-4-carboxamide (PubChem CID 164616063) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 7-methoxy-N-(4-methylphenyl)-2-phenylquinoline-4-carboxamide.
| Compound Name | 7-methoxy-N-(4-methylphenyl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 164616063 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 7-methoxy-N-(4-methylphenyl)-2-phenylquinoline-4-carboxamide |
| SMILES | COc1ccc2c(C(=O)Nc3ccc(C)cc3)cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C24H20N2O2/c1-16-8-10-18(11-9-16)25-24(27)21-15-22(17-6-4-3-5-7-17)26-23-14-19(28-2)12-13-20(21)23/h3-15H,1-2H3,(H,25,27) |
| InChIKey | ZLNLUODSERYAFS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |