C23H16Cl2N2O2 — CID 175308074
N-(3,4-dichlorophenyl)-7-methoxy-2-phenylquinoline-4-carboxamide (PubChem CID 175308074) has the molecular formula C23H16Cl2N2O2 and a molecular weight of 423.30 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-7-methoxy-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-7-methoxy-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 175308074 |
| Molecular Formula | C23H16Cl2N2O2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-7-methoxy-2-phenylquinoline-4-carboxamide |
| SMILES | COc1ccc2c(C(=O)Nc3ccc(Cl)c(Cl)c3)cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C23H16Cl2N2O2/c1-29-16-8-9-17-18(23(28)26-15-7-10-19(24)20(25)11-15)13-21(27-22(17)12-16)14-5-3-2-4-6-14/h2-13H,1H3,(H,26,28) |
| InChIKey | YOUHVDHBENPCQO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |