C23H16Cl2N2O — CID 3131018
N-(3,4-dichlorophenyl)-6-methyl-2-phenylquinoline-4-carboxamide (PubChem CID 3131018) has the molecular formula C23H16Cl2N2O and a molecular weight of 407.30 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-methyl-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-6-methyl-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3131018 |
| Molecular Formula | C23H16Cl2N2O |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-methyl-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccccc3)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H16Cl2N2O/c1-14-7-10-21-17(11-14)18(13-22(27-21)15-5-3-2-4-6-15)23(28)26-16-8-9-19(24)20(25)12-16/h2-13H,1H3,(H,26,28) |
| InChIKey | TXMDAAPZYIVMEA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |