C23H19N3O — CID 16573417
6-methyl-N-(4-methyl-2-pyridinyl)-2-phenylquinoline-4-carboxamide (PubChem CID 16573417) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-methyl-N-(4-methyl-2-pyridinyl)-2-phenylquinoline-4-carboxamide.
| Compound Name | 6-methyl-N-(4-methyl-2-pyridinyl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 16573417 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 6-methyl-N-(4-methyl-2-pyridinyl)-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)c2cc(-c3ccccc3)nc3ccc(C)cc23)c1 |
| InChI | InChI=1S/C23H19N3O/c1-15-8-9-20-18(12-15)19(14-21(25-20)17-6-4-3-5-7-17)23(27)26-22-13-16(2)10-11-24-22/h3-14H,1-2H3,(H,24,26,27) |
| InChIKey | GNCVZFKNNUFJNL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |