C31H22N2O3 — CID 164624795
N-[4-(1-benzofuran-2-yl)phenyl]-7-methoxy-2-phenylquinoline-4-carboxamide (PubChem CID 164624795) has the molecular formula C31H22N2O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[4-(1-benzofuran-2-yl)phenyl]-7-methoxy-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[4-(1-benzofuran-2-yl)phenyl]-7-methoxy-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 164624795 |
| Molecular Formula | C31H22N2O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[4-(1-benzofuran-2-yl)phenyl]-7-methoxy-2-phenylquinoline-4-carboxamide |
| SMILES | COc1ccc2c(C(=O)Nc3ccc(-c4cc5ccccc5o4)cc3)cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C31H22N2O3/c1-35-24-15-16-25-26(19-27(33-28(25)18-24)20-7-3-2-4-8-20)31(34)32-23-13-11-21(12-14-23)30-17-22-9-5-6-10-29(22)36-30/h2-19H,1H3,(H,32,34) |
| InChIKey | QUDILTKRZLHVCE-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |