C25H22N2O4 — CID 4557332
2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 4557332) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4557332 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(-c3ccc(OC)c(OC)c3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-29-18-11-9-17(10-12-18)26-25(28)20-15-22(27-21-7-5-4-6-19(20)21)16-8-13-23(30-2)24(14-16)31-3/h4-15H,1-3H3,(H,26,28) |
| InChIKey | IKWOWMYTHPBAAX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |