C26H23N3O4 — CID 56516872
N-(4-carbamoyl-3-methylphenyl)-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 56516872) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-(4-carbamoyl-3-methylphenyl)-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-(4-carbamoyl-3-methylphenyl)-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 56516872 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-(4-carbamoyl-3-methylphenyl)-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccc(C(N)=O)c(C)c3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C26H23N3O4/c1-15-12-17(9-10-18(15)25(27)30)28-26(31)20-14-22(29-21-7-5-4-6-19(20)21)16-8-11-23(32-2)24(13-16)33-3/h4-14H,1-3H3,(H2,27,30)(H,28,31) |
| InChIKey | QCMYRVPHJVBJFX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |