C25H21N3O5 — CID 2930791
2-(3,4-dimethoxyphenyl)-N-(4-methyl-2-nitrophenyl)quinoline-4-carboxamide (PubChem CID 2930791) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(4-methyl-2-nitrophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(4-methyl-2-nitrophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2930791 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(4-methyl-2-nitrophenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccc(C)cc3[N+](=O)[O-])c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C25H21N3O5/c1-15-8-10-20(22(12-15)28(30)31)27-25(29)18-14-21(26-19-7-5-4-6-17(18)19)16-9-11-23(32-2)24(13-16)33-3/h4-14H,1-3H3,(H,27,29) |
| InChIKey | QACIOMNDTXREJQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|