C35H35N3O5 — CID 22917190
N-[4-[2-[1-(3,4-dimethoxyphenyl)ethylamino]ethoxy]phenyl]-2-(3-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 22917190) has the molecular formula C35H35N3O5 and a molecular weight of 577.68 g/mol. Its IUPAC name is N-[4-[2-[1-(3,4-dimethoxyphenyl)ethylamino]ethoxy]phenyl]-2-(3-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[4-[2-[1-(3,4-dimethoxyphenyl)ethylamino]ethoxy]phenyl]-2-(3-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 22917190 |
| Molecular Formula | C35H35N3O5 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | N-[4-[2-[1-(3,4-dimethoxyphenyl)ethylamino]ethoxy]phenyl]-2-(3-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3ccc(OCCNC(C)c4ccc(OC)c(OC)c4)cc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C35H35N3O5/c1-23(24-12-17-33(41-3)34(21-24)42-4)36-18-19-43-27-15-13-26(14-16-27)37-35(39)30-22-32(25-8-7-9-28(20-25)40-2)38-31-11-6-5-10-29(30)31/h5-17,20-23,36H,18-19H2,1-4H3,(H,37,39) |
| InChIKey | PSIJEWYASVZPDV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|