C24H23N3O3S — CID 160607746
methane;N-[4-(methylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide (PubChem CID 160607746) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is methane;N-[4-(methylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | methane;N-[4-(methylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 160607746 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | methane;N-[4-(methylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide |
| SMILES | C.CNS(=O)(=O)c1ccc(NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H19N3O3S.CH4/c1-24-30(28,29)18-13-11-17(12-14-18)25-23(27)20-15-22(16-7-3-2-4-8-16)26-21-10-6-5-9-19(20)21;/h2-15,24H,1H3,(H,25,27);1H4 |
| InChIKey | RFCIRGCCAQMZJD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |