C27H29N3O3S — CID 158402633
N-[4-(diethylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide;methane (PubChem CID 158402633) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide;methane.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide;methane |
|---|---|
| PubChem CID | 158402633 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-phenylquinoline-4-carboxamide;methane |
| SMILES | C.CCN(CC)S(=O)(=O)c1ccc(NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H25N3O3S.CH4/c1-3-29(4-2)33(31,32)21-16-14-20(15-17-21)27-26(30)23-18-25(19-10-6-5-7-11-19)28-24-13-9-8-12-22(23)24;/h5-18H,3-4H2,1-2H3,(H,27,30);1H4 |
| InChIKey | GYHFXWGBEVTBBO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |