C29H29N3O5S — CID 2328657
2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2-phenylquinoline-4-carboxylate (PubChem CID 2328657) has the molecular formula C29H29N3O5S and a molecular weight of 531.63 g/mol. Its IUPAC name is 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2-phenylquinoline-4-carboxylate.
| Compound Name | 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2328657 |
| Molecular Formula | C29H29N3O5S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2-[[4-(diethylsulfamoyl)benzoyl]amino]ethyl 2-phenylquinoline-4-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCOC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C29H29N3O5S/c1-3-32(4-2)38(35,36)23-16-14-22(15-17-23)28(33)30-18-19-37-29(34)25-20-27(21-10-6-5-7-11-21)31-26-13-9-8-12-24(25)26/h5-17,20H,3-4,18-19H2,1-2H3,(H,30,33) |
| InChIKey | KESQPCNJCHCFBW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|